C16H30 — CID 143331465
1-cyclohexyl-2,3-diethylcyclohexane (PubChem CID 143331465) has the molecular formula C16H30 and a molecular weight of 222.42 g/mol. Its IUPAC name is 1-cyclohexyl-2,3-diethylcyclohexane.
| Compound Name | 1-cyclohexyl-2,3-diethylcyclohexane |
|---|---|
| PubChem CID | 143331465 |
| Molecular Formula | C16H30 |
| Molecular Weight | 222.42 g/mol |
| Exact Mass | 222.23 |
| IUPAC Name | 1-cyclohexyl-2,3-diethylcyclohexane |
| SMILES | CCC1CCCC(C2CCCCC2)C1CC |
| InChI | InChI=1S/C16H30/c1-3-13-11-8-12-16(15(13)4-2)14-9-6-5-7-10-14/h13-16H,3-12H2,1-2H3 |
| InChIKey | BGIYLLHKZRWVPR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |