C11H20 — CID 147174204
1-ethyl-2-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene (PubChem CID 147174204) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is 1-ethyl-2-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene.
| Compound Name | 1-ethyl-2-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene |
|---|---|
| PubChem CID | 147174204 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | 1-ethyl-2-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene |
| SMILES | CCC1C(C)CC2CCCC21 |
| InChI | InChI=1S/C11H20/c1-3-10-8(2)7-9-5-4-6-11(9)10/h8-11H,3-7H2,1-2H3 |
| InChIKey | BYHZARLKFUTQRW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |