C18H32 — CID 162289049
1-ethyl-2,3,4-trimethyl-2,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[b]naphthalene (PubChem CID 162289049) has the molecular formula C18H32 and a molecular weight of 248.45 g/mol. Its IUPAC name is 1-ethyl-2,3,4-trimethyl-2,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[b]naphthalene.
| Compound Name | 1-ethyl-2,3,4-trimethyl-2,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[b]naphthalene |
|---|---|
| PubChem CID | 162289049 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | 1-ethyl-2,3,4-trimethyl-2,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[b]naphthalene |
| SMILES | CCC1C(C)C(C)C2C(C)C3CCCCC3CC12 |
| InChI | InChI=1S/C18H32/c1-5-15-11(2)12(3)18-13(4)16-9-7-6-8-14(16)10-17(15)18/h11-18H,5-10H2,1-4H3 |
| InChIKey | LXORXTDUYUMZPZ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |