C21H34 — CID 162302289
(2R,3R,8R)-13-ethyl-2,14-dimethyl-16-methylidenetetracyclo[8.6.0.03,8.011,15]hexadecane (PubChem CID 162302289) has the molecular formula C21H34 and a molecular weight of 286.50 g/mol. Its IUPAC name is (2R,3R,8R)-13-ethyl-2,14-dimethyl-16-methylidenetetracyclo[8.6.0.03,8.011,15]hexadecane.
| Compound Name | (2R,3R,8R)-13-ethyl-2,14-dimethyl-16-methylidenetetracyclo[8.6.0.03,8.011,15]hexadecane |
|---|---|
| PubChem CID | 162302289 |
| Molecular Formula | C21H34 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | (2R,3R,8R)-13-ethyl-2,14-dimethyl-16-methylidenetetracyclo[8.6.0.03,8.011,15]hexadecane |
| SMILES | C=C1C2C(C)C(CC)CC2C2C[C@H]3CCCC[C@H]3[C@@H](C)C12 |
| InChI | InChI=1S/C21H34/c1-5-15-10-18-19-11-16-8-6-7-9-17(16)13(3)21(19)14(4)20(18)12(15)2/h12-13,15-21H,4-11H2,1-3H3/t12?,13-,15?,16-,17+,18?,19?,20?,21?/m1/s1 |
| InChIKey | MZHCEUSWBIQBDA-QTXZDULDSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|