C22H36 — CID 162302290
(5aR,9aR)-2-ethyl-3,5-dimethyl-4-methylidene-1,2,3,3a,4a,5,5a,6,7,8,9,9a,10,10a,11,11a-hexadecahydrocyclopenta[b]anthracene (PubChem CID 162302290) has the molecular formula C22H36 and a molecular weight of 300.53 g/mol. Its IUPAC name is (5aR,9aR)-2-ethyl-3,5-dimethyl-4-methylidene-1,2,3,3a,4a,5,5a,6,7,8,9,9a,10,10a,11,11a-hexadecahydrocyclopenta[b]anthracene.
| Compound Name | (5aR,9aR)-2-ethyl-3,5-dimethyl-4-methylidene-1,2,3,3a,4a,5,5a,6,7,8,9,9a,10,10a,11,11a-hexadecahydrocyclopenta[b]anthracene |
|---|---|
| PubChem CID | 162302290 |
| Molecular Formula | C22H36 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | (5aR,9aR)-2-ethyl-3,5-dimethyl-4-methylidene-1,2,3,3a,4a,5,5a,6,7,8,9,9a,10,10a,11,11a-hexadecahydrocyclopenta[b]anthracene |
| SMILES | C=C1C2C(CC(CC)C2C)CC2C[C@H]3CCCC[C@H]3C(C)C12 |
| InChI | InChI=1S/C22H36/c1-5-16-10-18-12-19-11-17-8-6-7-9-20(17)14(3)22(19)15(4)21(18)13(16)2/h13-14,16-22H,4-12H2,1-3H3/t13?,14?,16?,17-,18?,19?,20+,21?,22?/m1/s1 |
| InChIKey | QNTIKBLNKJCLFX-STTSBYHNSA-N |
| XLogP | 6.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|