C28H44 — CID 162283929
(5S,10S,11S,17R,22R)-11,16-dimethyl-13-methylidenehexacyclo[12.11.0.03,12.05,10.015,24.017,22]pentacosane (PubChem CID 162283929) has the molecular formula C28H44 and a molecular weight of 380.66 g/mol. Its IUPAC name is (5S,10S,11S,17R,22R)-11,16-dimethyl-13-methylidenehexacyclo[12.11.0.03,12.05,10.015,24.017,22]pentacosane.
| Compound Name | (5S,10S,11S,17R,22R)-11,16-dimethyl-13-methylidenehexacyclo[12.11.0.03,12.05,10.015,24.017,22]pentacosane |
|---|---|
| PubChem CID | 162283929 |
| Molecular Formula | C28H44 |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 380.34 |
| IUPAC Name | (5S,10S,11S,17R,22R)-11,16-dimethyl-13-methylidenehexacyclo[12.11.0.03,12.05,10.015,24.017,22]pentacosane |
| SMILES | C=C1C2C(CC3C[C@H]4CCCC[C@H]4C(C)C32)CC2C[C@@H]3CCCC[C@@H]3[C@H](C)C12 |
| InChI | InChI=1S/C28H44/c1-16-24-10-6-4-8-19(24)12-21-14-23-15-22-13-20-9-5-7-11-25(20)17(2)27(22)28(23)18(3)26(16)21/h16-17,19-28H,3-15H2,1-2H3/t16-,17?,19-,20+,21?,22?,23?,24+,25-,26?,27?,28?/m0/s1 |
| InChIKey | WZJPORZIEHZBKC-SYBAENCUSA-N |
| XLogP | 7.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|