C14H24 — CID 164599475
1,3-dimethyl-1,2,3,3a,4,4a,5,6,7,8,8a,8b-dodecahydrocyclopenta[a]indene (PubChem CID 164599475) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 1,3-dimethyl-1,2,3,3a,4,4a,5,6,7,8,8a,8b-dodecahydrocyclopenta[a]indene.
| Compound Name | 1,3-dimethyl-1,2,3,3a,4,4a,5,6,7,8,8a,8b-dodecahydrocyclopenta[a]indene |
|---|---|
| PubChem CID | 164599475 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 1,3-dimethyl-1,2,3,3a,4,4a,5,6,7,8,8a,8b-dodecahydrocyclopenta[a]indene |
| SMILES | CC1CC(C)C2C1CC1CCCCC12 |
| InChI | InChI=1S/C14H24/c1-9-7-10(2)14-12-6-4-3-5-11(12)8-13(9)14/h9-14H,3-8H2,1-2H3 |
| InChIKey | CJEVKYVCIIUISP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |