C11H20 — CID 144941851
(1R,3S,3aS)-1,3-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 144941851) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is (1R,3S,3aS)-1,3-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | (1R,3S,3aS)-1,3-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 144941851 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | (1R,3S,3aS)-1,3-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | C[C@@H]1C[C@H](C)[C@@H]2CCCCC12 |
| InChI | InChI=1S/C11H20/c1-8-7-9(2)11-6-4-3-5-10(8)11/h8-11H,3-7H2,1-2H3/t8-,9+,10-,11?/m0/s1 |
| InChIKey | VTLIIZSWAVAOCR-JDUUOCRZSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |