C15H27F — CID 170286025
6-fluoro-1,4-dimethyl-2,3,3a,4,5,6,7,8,9,10,11,11a-dodecahydro-1H-cyclopenta[10]annulene (PubChem CID 170286025) has the molecular formula C15H27F and a molecular weight of 226.38 g/mol. Its IUPAC name is 6-fluoro-1,4-dimethyl-2,3,3a,4,5,6,7,8,9,10,11,11a-dodecahydro-1H-cyclopenta[10]annulene.
| Compound Name | 6-fluoro-1,4-dimethyl-2,3,3a,4,5,6,7,8,9,10,11,11a-dodecahydro-1H-cyclopenta[10]annulene |
|---|---|
| PubChem CID | 170286025 |
| Molecular Formula | C15H27F |
| Molecular Weight | 226.38 g/mol |
| Exact Mass | 226.21 |
| IUPAC Name | 6-fluoro-1,4-dimethyl-2,3,3a,4,5,6,7,8,9,10,11,11a-dodecahydro-1H-cyclopenta[10]annulene |
| SMILES | CC1CCC2C(C)CC(F)CCCCCC12 |
| InChI | InChI=1S/C15H27F/c1-11-8-9-15-12(2)10-13(16)6-4-3-5-7-14(11)15/h11-15H,3-10H2,1-2H3 |
| InChIKey | HQDWFMIIWUBCHD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |