C12H22S — CID 139492923
2-ethylsulfanyl-1-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 139492923) has the molecular formula C12H22S and a molecular weight of 198.37 g/mol. Its IUPAC name is 2-ethylsulfanyl-1-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | 2-ethylsulfanyl-1-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 139492923 |
| Molecular Formula | C12H22S |
| Molecular Weight | 198.37 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 2-ethylsulfanyl-1-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CCSC1CC2CCCCC2C1C |
| InChI | InChI=1S/C12H22S/c1-3-13-12-8-10-6-4-5-7-11(10)9(12)2/h9-12H,3-8H2,1-2H3 |
| InChIKey | QQDJDCAVIXRAEK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |