C16H28 — CID 162292694
(4aR,8aS)-3-ethyl-2-methyl-2,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[b]naphthalene (PubChem CID 162292694) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is (4aR,8aS)-3-ethyl-2-methyl-2,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[b]naphthalene.
| Compound Name | (4aR,8aS)-3-ethyl-2-methyl-2,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[b]naphthalene |
|---|---|
| PubChem CID | 162292694 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | (4aR,8aS)-3-ethyl-2-methyl-2,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydro-1H-cyclopenta[b]naphthalene |
| SMILES | CCC1C(C)CC2C[C@@H]3CCCC[C@@H]3CC21 |
| InChI | InChI=1S/C16H28/c1-3-15-11(2)8-14-9-12-6-4-5-7-13(12)10-16(14)15/h11-16H,3-10H2,1-2H3/t11?,12-,13+,14?,15?,16?/m0/s1 |
| InChIKey | BIXSTVDSADXFIU-LTJIUFDJSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |