C17H34 — CID 91264687
ethane;1-ethyl-2-methyl-7-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene (PubChem CID 91264687) has the molecular formula C17H34 and a molecular weight of 238.46 g/mol. Its IUPAC name is ethane;1-ethyl-2-methyl-7-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene.
| Compound Name | ethane;1-ethyl-2-methyl-7-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
|---|---|
| PubChem CID | 91264687 |
| Molecular Formula | C17H34 |
| Molecular Weight | 238.46 g/mol |
| Exact Mass | 238.27 |
| IUPAC Name | ethane;1-ethyl-2-methyl-7-propyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene |
| SMILES | CC.CCCC1CCCC2CC(C)C(CC)C12 |
| InChI | InChI=1S/C15H28.C2H6/c1-4-7-12-8-6-9-13-10-11(3)14(5-2)15(12)13;1-2/h11-15H,4-10H2,1-3H3;1-2H3 |
| InChIKey | RYLXFIWECYHHGW-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.46 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |