C31H58 — CID 157261713
5-butyl-4-cyclohexyl-6-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;1,4-dimethyl-2-propylcyclohexane (PubChem CID 157261713) has the molecular formula C31H58 and a molecular weight of 430.81 g/mol. Its IUPAC name is 5-butyl-4-cyclohexyl-6-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;1,4-dimethyl-2-propylcyclohexane.
| Compound Name | 5-butyl-4-cyclohexyl-6-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;1,4-dimethyl-2-propylcyclohexane |
|---|---|
| PubChem CID | 157261713 |
| Molecular Formula | C31H58 |
| Molecular Weight | 430.81 g/mol |
| Exact Mass | 430.45 |
| IUPAC Name | 5-butyl-4-cyclohexyl-6-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indene;1,4-dimethyl-2-propylcyclohexane |
| SMILES | CCCC1CC(C)CCC1C.CCCCC1C(C)CC2CCCC2C1C1CCCCC1 |
| InChI | InChI=1S/C20H36.C11H22/c1-3-4-12-18-15(2)14-17-11-8-13-19(17)20(18)16-9-6-5-7-10-16;1-4-5-11-8-9(2)6-7-10(11)3/h15-20H,3-14H2,1-2H3;9-11H,4-8H2,1-3H3 |
| InChIKey | AXNRDARLIALQTM-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.81 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |