About bicyclo[5.1.0]octane;1-butyl-2-methylcyclopropane;bis(octane)
bicyclo[5.1.0]octane;1-butyl-2-methylcyclopropane;bis(octane) (PubChem CID 173410079) has the molecular formula C32H66
and a molecular weight of 450.88 g/mol. Its IUPAC name is bicyclo[5.1.0]octane;1-butyl-2-methylcyclopropane;bis(octane).
Molecular Properties
| Compound Name | bicyclo[5.1.0]octane;1-butyl-2-methylcyclopropane;bis(octane) |
| PubChem CID | 173410079 |
| Molecular Formula | C32H66 |
| Molecular Weight | 450.88 g/mol |
| Exact Mass | 450.52 |
| IUPAC Name | bicyclo[5.1.0]octane;1-butyl-2-methylcyclopropane;bis(octane) |
| SMILES | C1CCC2CC2CC1.CCCCC1CC1C.CCCCCCCC.CCCCCCCC |
| InChI | InChI=1S/C8H14.C8H16.2C8H18/c1-2-4-7-6-8(7)5-3-1;1-3-4-5-8-6-7(8)2;2*1-3-5-7-8-6-4-2/h7-8H,1-6H2;7-8H,3-6H2,1-2H3;2*3-8H2,1-2H3 |
| InChIKey | ZLHAZTCPCIGMGO-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.88 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[5.1.0]octane;1-butyl-2-methylcyclopropane;bis(octane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[5.1.0]octane;1-butyl-2-methylcyclopropane;bis(octane)?
The IUPAC name of bicyclo[5.1.0]octane;1-butyl-2-methylcyclopropane;bis(octane) (CID 173410079) is bicyclo[5.1.0]octane;1-butyl-2-methylcyclopropane;bis(octane).
What is the SMILES notation for bicyclo[5.1.0]octane;1-butyl-2-methylcyclopropane;bis(octane)?
The canonical SMILES for bicyclo[5.1.0]octane;1-butyl-2-methylcyclopropane;bis(octane) is C1CCC2CC2CC1.CCCCC1CC1C.CCCCCCCC.CCCCCCCC.
What is the InChIKey of bicyclo[5.1.0]octane;1-butyl-2-methylcyclopropane;bis(octane)?
The InChIKey is ZLHAZTCPCIGMGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14.C8H16.2C8H18/c1-2-4-7-6-8(7)5-3-1;1-3-4-5-8-6-7(8)2;2*1-3-5-7-8-6-4-2/h7-8H,1-6H2;7-8H,3-6H2,1-2H3;2*3-8H2,1-2H3.
What are the key properties of bicyclo[5.1.0]octane;1-butyl-2-methylcyclopropane;bis(octane)?
bicyclo[5.1.0]octane;1-butyl-2-methylcyclopropane;bis(octane) has a molecular weight of 450.88 g/mol, XLogP of 12.15, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[5.1.0]octane;1-butyl-2-methylcyclopropane;bis(octane) is sourced from PubChem (CID 173410079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).