C15H32 — CID 142453951
cis-(1R,2S)-1,2-dimethylcyclohexane;heptane (PubChem CID 142453951) has the molecular formula C15H32 and a molecular weight of 212.42 g/mol. Its IUPAC name is cis-(1R,2S)-1,2-dimethylcyclohexane;heptane.
| Compound Name | cis-(1R,2S)-1,2-dimethylcyclohexane;heptane |
|---|---|
| PubChem CID | 142453951 |
| Molecular Formula | C15H32 |
| Molecular Weight | 212.42 g/mol |
| Exact Mass | 212.25 |
| IUPAC Name | cis-(1R,2S)-1,2-dimethylcyclohexane;heptane |
| SMILES | CCCCCCC.C[C@@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C8H16.C7H16/c1-7-5-3-4-6-8(7)2;1-3-5-7-6-4-2/h7-8H,3-6H2,1-2H3;3-7H2,1-2H3/t7-,8+; |
| InChIKey | RGUMVWPDXWDCKW-KVZVIFLMSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.42 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|