C11H24 — CID 142846915
1,2-dimethylcyclobutane;pentane (PubChem CID 142846915) has the molecular formula C11H24 and a molecular weight of 156.31 g/mol. Its IUPAC name is 1,2-dimethylcyclobutane;pentane.
| Compound Name | 1,2-dimethylcyclobutane;pentane |
|---|---|
| PubChem CID | 142846915 |
| Molecular Formula | C11H24 |
| Molecular Weight | 156.31 g/mol |
| Exact Mass | 156.19 |
| IUPAC Name | 1,2-dimethylcyclobutane;pentane |
| SMILES | CC1CCC1C.CCCCC |
| InChI | InChI=1S/C6H12.C5H12/c1-5-3-4-6(5)2;1-3-5-4-2/h5-6H,3-4H2,1-2H3;3-5H2,1-2H3 |
| InChIKey | PJQRYGVUVXPAFN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |