About 1-ethyl-4-methylcyclohexane;pentane
1-ethyl-4-methylcyclohexane;pentane (PubChem CID 159787850) has the molecular formula C14H30
and a molecular weight of 198.39 g/mol. Its IUPAC name is 1-ethyl-4-methylcyclohexane;pentane.
Molecular Properties
| Compound Name | 1-ethyl-4-methylcyclohexane;pentane |
| PubChem CID | 159787850 |
| Molecular Formula | C14H30 |
| Molecular Weight | 198.39 g/mol |
| Exact Mass | 198.23 |
| IUPAC Name | 1-ethyl-4-methylcyclohexane;pentane |
| SMILES | CCC1CCC(C)CC1.CCCCC |
| InChI | InChI=1S/C9H18.C5H12/c1-3-9-6-4-8(2)5-7-9;1-3-5-4-2/h8-9H,3-7H2,1-2H3;3-5H2,1-2H3 |
| InChIKey | NIEKEYTUAOQZNK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 198.39 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethyl-4-methylcyclohexane;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-methylcyclohexane;pentane?
The IUPAC name of 1-ethyl-4-methylcyclohexane;pentane (CID 159787850) is 1-ethyl-4-methylcyclohexane;pentane.
What is the SMILES notation for 1-ethyl-4-methylcyclohexane;pentane?
The canonical SMILES for 1-ethyl-4-methylcyclohexane;pentane is CCC1CCC(C)CC1.CCCCC.
What is the InChIKey of 1-ethyl-4-methylcyclohexane;pentane?
The InChIKey is NIEKEYTUAOQZNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C5H12/c1-3-9-6-4-8(2)5-7-9;1-3-5-4-2/h8-9H,3-7H2,1-2H3;3-5H2,1-2H3.
What are the key properties of 1-ethyl-4-methylcyclohexane;pentane?
1-ethyl-4-methylcyclohexane;pentane has a molecular weight of 198.39 g/mol, XLogP of 5.42, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-methylcyclohexane;pentane is sourced from PubChem (CID 159787850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).