C8H16 — CID 6432281
trans-(1R,3R)-1-ethyl-3-methylcyclopentane (PubChem CID 6432281) has the molecular formula C8H16 and a molecular weight of 112.22 g/mol. Its IUPAC name is trans-(1R,3R)-1-ethyl-3-methylcyclopentane.
| Compound Name | trans-(1R,3R)-1-ethyl-3-methylcyclopentane |
|---|---|
| PubChem CID | 6432281 |
| Molecular Formula | C8H16 |
| Molecular Weight | 112.22 g/mol |
| Exact Mass | 112.13 |
| IUPAC Name | trans-(1R,3R)-1-ethyl-3-methylcyclopentane |
| SMILES | CC[C@@H]1CC[C@@H](C)C1 |
| InChI | InChI=1S/C8H16/c1-3-8-5-4-7(2)6-8/h7-8H,3-6H2,1-2H3/t7-,8-/m1/s1 |
| InChIKey | PQXAPVOKLYINEI-HTQZYQBOSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |