C9H18 — CID 530396
1,3-diethylcyclopentane (PubChem CID 530396) has the molecular formula C9H18 and a molecular weight of 126.24 g/mol. Its IUPAC name is 1,3-diethylcyclopentane.
| Compound Name | 1,3-diethylcyclopentane |
|---|---|
| PubChem CID | 530396 |
| Molecular Formula | C9H18 |
| Molecular Weight | 126.24 g/mol |
| Exact Mass | 126.14 |
| IUPAC Name | 1,3-diethylcyclopentane |
| SMILES | CCC1CCC(CC)C1 |
| InChI | InChI=1S/C9H18/c1-3-8-5-6-9(4-2)7-8/h8-9H,3-7H2,1-2H3 |
| InChIKey | RUUVWUNHERVOAY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |