C15H36 — CID 161327157
1,3-diethylcyclobutane;methane;propane (PubChem CID 161327157) has the molecular formula C15H36 and a molecular weight of 216.45 g/mol. Its IUPAC name is 1,3-diethylcyclobutane;methane;propane.
| Compound Name | 1,3-diethylcyclobutane;methane;propane |
|---|---|
| PubChem CID | 161327157 |
| Molecular Formula | C15H36 |
| Molecular Weight | 216.45 g/mol |
| Exact Mass | 216.28 |
| IUPAC Name | 1,3-diethylcyclobutane;methane;propane |
| SMILES | C.CCC.CCC.CCC1CC(CC)C1 |
| InChI | InChI=1S/C8H16.2C3H8.CH4/c1-3-7-5-8(4-2)6-7;2*1-3-2;/h7-8H,3-6H2,1-2H3;2*3H2,1-2H3;1H4 |
| InChIKey | VKXNPIDFBIHMNZ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.45 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |