C9H18 — CID 149056409
(2S)-4-ethyl-1,2-dimethylcyclopentane (PubChem CID 149056409) has the molecular formula C9H18 and a molecular weight of 126.24 g/mol. Its IUPAC name is (2S)-4-ethyl-1,2-dimethylcyclopentane.
| Compound Name | (2S)-4-ethyl-1,2-dimethylcyclopentane |
|---|---|
| PubChem CID | 149056409 |
| Molecular Formula | C9H18 |
| Molecular Weight | 126.24 g/mol |
| Exact Mass | 126.14 |
| IUPAC Name | (2S)-4-ethyl-1,2-dimethylcyclopentane |
| SMILES | CCC1CC(C)[C@@H](C)C1 |
| InChI | InChI=1S/C9H18/c1-4-9-5-7(2)8(3)6-9/h7-9H,4-6H2,1-3H3/t7-,8?,9?/m0/s1 |
| InChIKey | QKXQNQVXTYSGKS-UEJVZZJDSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |