About (2S)-4-ethyl-1,2-dimethylcyclopentane
(2S)-4-ethyl-1,2-dimethylcyclopentane (PubChem CID 149056409) has the molecular formula C9H18
and a molecular weight of 126.24 g/mol. Its IUPAC name is (2S)-4-ethyl-1,2-dimethylcyclopentane.
Molecular Properties
| Compound Name | (2S)-4-ethyl-1,2-dimethylcyclopentane |
| PubChem CID | 149056409 |
| Molecular Formula | C9H18 |
| Molecular Weight | 126.24 g/mol |
| Exact Mass | 126.14 |
| IUPAC Name | (2S)-4-ethyl-1,2-dimethylcyclopentane |
| SMILES | CCC1CC(C)[C@@H](C)C1 |
| InChI | InChI=1S/C9H18/c1-4-9-5-7(2)8(3)6-9/h7-9H,4-6H2,1-3H3/t7-,8?,9?/m0/s1 |
| InChIKey | QKXQNQVXTYSGKS-UEJVZZJDSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (2S)-4-ethyl-1,2-dimethylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-ethyl-1,2-dimethylcyclopentane?
The IUPAC name of (2S)-4-ethyl-1,2-dimethylcyclopentane (CID 149056409) is (2S)-4-ethyl-1,2-dimethylcyclopentane.
What is the SMILES notation for (2S)-4-ethyl-1,2-dimethylcyclopentane?
The canonical SMILES for (2S)-4-ethyl-1,2-dimethylcyclopentane is CCC1CC(C)[C@@H](C)C1.
What is the InChIKey of (2S)-4-ethyl-1,2-dimethylcyclopentane?
The InChIKey is QKXQNQVXTYSGKS-UEJVZZJDSA-N. The full InChI is InChI=1S/C9H18/c1-4-9-5-7(2)8(3)6-9/h7-9H,4-6H2,1-3H3/t7-,8?,9?/m0/s1.
What are the key properties of (2S)-4-ethyl-1,2-dimethylcyclopentane?
(2S)-4-ethyl-1,2-dimethylcyclopentane has a molecular weight of 126.24 g/mol, XLogP of 3.08, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-ethyl-1,2-dimethylcyclopentane is sourced from PubChem (CID 149056409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).