About 1,5-diethyl-2,3-dimethylcyclohexane
1,5-diethyl-2,3-dimethylcyclohexane (PubChem CID 557905) has the molecular formula C12H24
and a molecular weight of 168.32 g/mol. Its IUPAC name is 1,5-diethyl-2,3-dimethylcyclohexane.
Molecular Properties
| Compound Name | 1,5-diethyl-2,3-dimethylcyclohexane |
| PubChem CID | 557905 |
| Molecular Formula | C12H24 |
| Molecular Weight | 168.32 g/mol |
| Exact Mass | 168.19 |
| IUPAC Name | 1,5-diethyl-2,3-dimethylcyclohexane |
| SMILES | CCC1CC(C)C(C)C(CC)C1 |
| InChI | InChI=1S/C12H24/c1-5-11-7-9(3)10(4)12(6-2)8-11/h9-12H,5-8H2,1-4H3 |
| InChIKey | LIPDNVJRSSRBTE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,5-diethyl-2,3-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-diethyl-2,3-dimethylcyclohexane?
The IUPAC name of 1,5-diethyl-2,3-dimethylcyclohexane (CID 557905) is 1,5-diethyl-2,3-dimethylcyclohexane.
What is the SMILES notation for 1,5-diethyl-2,3-dimethylcyclohexane?
The canonical SMILES for 1,5-diethyl-2,3-dimethylcyclohexane is CCC1CC(C)C(C)C(CC)C1.
What is the InChIKey of 1,5-diethyl-2,3-dimethylcyclohexane?
The InChIKey is LIPDNVJRSSRBTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24/c1-5-11-7-9(3)10(4)12(6-2)8-11/h9-12H,5-8H2,1-4H3.
What are the key properties of 1,5-diethyl-2,3-dimethylcyclohexane?
1,5-diethyl-2,3-dimethylcyclohexane has a molecular weight of 168.32 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diethyl-2,3-dimethylcyclohexane is sourced from PubChem (CID 557905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).