C13H24 — CID 123325813
5-ethyl-3,6,7-trimethylcyclooctene (PubChem CID 123325813) has the molecular formula C13H24 and a molecular weight of 180.34 g/mol. Its IUPAC name is 5-ethyl-3,6,7-trimethylcyclooctene.
| Compound Name | 5-ethyl-3,6,7-trimethylcyclooctene |
|---|---|
| PubChem CID | 123325813 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.34 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 5-ethyl-3,6,7-trimethylcyclooctene |
| SMILES | CCC1CC(C)C=CCC(C)C1C |
| InChI | InChI=1S/C13H24/c1-5-13-9-10(2)7-6-8-11(3)12(13)4/h6-7,10-13H,5,8-9H2,1-4H3 |
| InChIKey | ZUUJZIVPJICJCH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.34 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|