C21H40 — CID 123296538
5-ethyl-3,8,9-trimethyl-7-(3-methylpentan-2-yl)cyclodecene (PubChem CID 123296538) has the molecular formula C21H40 and a molecular weight of 292.55 g/mol. Its IUPAC name is 5-ethyl-3,8,9-trimethyl-7-(3-methylpentan-2-yl)cyclodecene.
| Compound Name | 5-ethyl-3,8,9-trimethyl-7-(3-methylpentan-2-yl)cyclodecene |
|---|---|
| PubChem CID | 123296538 |
| Molecular Formula | C21H40 |
| Molecular Weight | 292.55 g/mol |
| Exact Mass | 292.31 |
| IUPAC Name | 5-ethyl-3,8,9-trimethyl-7-(3-methylpentan-2-yl)cyclodecene |
| SMILES | CCC1CC(C)C=CCC(C)C(C)C(C(C)C(C)CC)C1 |
| InChI | InChI=1S/C21H40/c1-8-16(4)18(6)21-14-20(9-2)13-15(3)11-10-12-17(5)19(21)7/h10-11,15-21H,8-9,12-14H2,1-7H3 |
| InChIKey | WKCGOIGDNZHMGW-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.55 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|