C9H14O — CID 11040773
1-[(1S,5R)-5-methylcyclohex-3-en-1-yl]ethanone (PubChem CID 11040773) has the molecular formula C9H14O and a molecular weight of 138.21 g/mol. Its IUPAC name is 1-[(1S,5R)-5-methylcyclohex-3-en-1-yl]ethanone.
| Compound Name | 1-[(1S,5R)-5-methylcyclohex-3-en-1-yl]ethanone |
|---|---|
| PubChem CID | 11040773 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 1-[(1S,5R)-5-methylcyclohex-3-en-1-yl]ethanone |
| SMILES | CC(=O)[C@H]1CC=C[C@H](C)C1 |
| InChI | InChI=1S/C9H14O/c1-7-4-3-5-9(6-7)8(2)10/h3-4,7,9H,5-6H2,1-2H3/t7-,9-/m0/s1 |
| InChIKey | SMFFYCMTESNKHN-CBAPKCEASA-N |
| XLogP | 2.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|