C10H16O — CID 175990240
1-[(1R,3Z)-cyclooct-3-en-1-yl]ethanone (PubChem CID 175990240) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-[(1R,3Z)-cyclooct-3-en-1-yl]ethanone.
| Compound Name | 1-[(1R,3Z)-cyclooct-3-en-1-yl]ethanone |
|---|---|
| PubChem CID | 175990240 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 1-[(1R,3Z)-cyclooct-3-en-1-yl]ethanone |
| SMILES | CC(=O)[C@H]1C/C=C\CCCC1 |
| InChI | InChI=1S/C10H16O/c1-9(11)10-7-5-3-2-4-6-8-10/h3,5,10H,2,4,6-8H2,1H3/b5-3-/t10-/m0/s1 |
| InChIKey | OTAKUJWURRXKOW-ATPLWMGHSA-N |
| XLogP | 2.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|