C8H14S — CID 143060463
5,6-dimethylcyclohex-2-ene-1-thiol (PubChem CID 143060463) has the molecular formula C8H14S and a molecular weight of 142.27 g/mol. Its IUPAC name is 5,6-dimethylcyclohex-2-ene-1-thiol.
| Compound Name | 5,6-dimethylcyclohex-2-ene-1-thiol |
|---|---|
| PubChem CID | 143060463 |
| Molecular Formula | C8H14S |
| Molecular Weight | 142.27 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | 5,6-dimethylcyclohex-2-ene-1-thiol |
| SMILES | CC1CC=CC(S)C1C |
| InChI | InChI=1S/C8H14S/c1-6-4-3-5-8(9)7(6)2/h3,5-9H,4H2,1-2H3 |
| InChIKey | GWNWFSUXBYUYKZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|