C7H12 — CID 145216424
(4S)-3,4-dimethylcyclopentene (PubChem CID 145216424) has the molecular formula C7H12 and a molecular weight of 96.17 g/mol. Its IUPAC name is (4S)-3,4-dimethylcyclopentene.
| Compound Name | (4S)-3,4-dimethylcyclopentene |
|---|---|
| PubChem CID | 145216424 |
| Molecular Formula | C7H12 |
| Molecular Weight | 96.17 g/mol |
| Exact Mass | 96.09 |
| IUPAC Name | (4S)-3,4-dimethylcyclopentene |
| SMILES | CC1C=CC[C@@H]1C |
| InChI | InChI=1S/C7H12/c1-6-4-3-5-7(6)2/h3-4,6-7H,5H2,1-2H3/t6?,7-/m0/s1 |
| InChIKey | JOVGLRSLWFSVNB-MLWJPKLSSA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 96.17 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|