C15H20O — CID 10910958
(1S,4aS,4bS,8S,8aS,9aS)-1,8-dimethyl-1,4,4a,4b,5,8,8a,9a-octahydrofluoren-9-one (PubChem CID 10910958) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is (1S,4aS,4bS,8S,8aS,9aS)-1,8-dimethyl-1,4,4a,4b,5,8,8a,9a-octahydrofluoren-9-one.
| Compound Name | (1S,4aS,4bS,8S,8aS,9aS)-1,8-dimethyl-1,4,4a,4b,5,8,8a,9a-octahydrofluoren-9-one |
|---|---|
| PubChem CID | 10910958 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | (1S,4aS,4bS,8S,8aS,9aS)-1,8-dimethyl-1,4,4a,4b,5,8,8a,9a-octahydrofluoren-9-one |
| SMILES | C[C@H]1C=CC[C@H]2[C@@H]3CC=C[C@H](C)[C@@H]3C(=O)[C@H]21 |
| InChI | InChI=1S/C15H20O/c1-9-5-3-7-11-12-8-4-6-10(2)14(12)15(16)13(9)11/h3-6,9-14H,7-8H2,1-2H3/t9-,10-,11-,12-,13-,14-/m0/s1 |
| InChIKey | GBEBARGQPYHTRP-LHEWDLALSA-N |
| XLogP | 3.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|