C10H10O — CID 102033792
(1S,7S)-tricyclo[5.2.1.02,6]deca-3,8-dien-10-one (PubChem CID 102033792) has the molecular formula C10H10O and a molecular weight of 146.19 g/mol. Its IUPAC name is (1S,7S)-tricyclo[5.2.1.02,6]deca-3,8-dien-10-one.
| Compound Name | (1S,7S)-tricyclo[5.2.1.02,6]deca-3,8-dien-10-one |
|---|---|
| PubChem CID | 102033792 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | (1S,7S)-tricyclo[5.2.1.02,6]deca-3,8-dien-10-one |
| SMILES | O=C1[C@H]2C=C[C@H]1C1CC=CC12 |
| InChI | InChI=1S/C10H10O/c11-10-8-4-5-9(10)7-3-1-2-6(7)8/h1-2,4-9H,3H2/t6?,7?,8-,9-/m0/s1 |
| InChIKey | MCMMLGNEUXFJPF-PEBLOWIWSA-N |
| XLogP | 1.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|