C7H7ClO — CID 12951165
(1R,5S,7S)-7-chlorobicyclo[3.2.0]hept-2-en-6-one (PubChem CID 12951165) has the molecular formula C7H7ClO and a molecular weight of 142.59 g/mol. Its IUPAC name is (1R,5S,7S)-7-chlorobicyclo[3.2.0]hept-2-en-6-one.
| Compound Name | (1R,5S,7S)-7-chlorobicyclo[3.2.0]hept-2-en-6-one |
|---|---|
| PubChem CID | 12951165 |
| Molecular Formula | C7H7ClO |
| Molecular Weight | 142.59 g/mol |
| Exact Mass | 142.02 |
| IUPAC Name | (1R,5S,7S)-7-chlorobicyclo[3.2.0]hept-2-en-6-one |
| SMILES | O=C1[C@@H](Cl)[C@@H]2C=CC[C@H]12 |
| InChI | InChI=1S/C7H7ClO/c8-6-4-2-1-3-5(4)7(6)9/h1-2,4-6H,3H2/t4-,5+,6+/m1/s1 |
| InChIKey | TXTJXMFCYYBLNX-SRQIZXRXSA-N |
| XLogP | 1.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.59 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|