C10H10O3 — CID 130028036
1a,2a,3,6,6a,7a-hexahydronaphtho[2,3-b]oxirene-2,7-dione (PubChem CID 130028036) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is 1a,2a,3,6,6a,7a-hexahydronaphtho[2,3-b]oxirene-2,7-dione.
| Compound Name | 1a,2a,3,6,6a,7a-hexahydronaphtho[2,3-b]oxirene-2,7-dione |
|---|---|
| PubChem CID | 130028036 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 1a,2a,3,6,6a,7a-hexahydronaphtho[2,3-b]oxirene-2,7-dione |
| SMILES | O=C1C2CC=CCC2C(=O)C2OC12 |
| InChI | InChI=1S/C10H10O3/c11-7-5-3-1-2-4-6(5)8(12)10-9(7)13-10/h1-2,5-6,9-10H,3-4H2 |
| InChIKey | RONZMAUAUJUHOB-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|