C15H16O2 — CID 135038227
(6Z,12S,14R)-pentacyclo[7.5.1.02,12.04,11.010,14]pentadec-6-ene-3,15-dione (PubChem CID 135038227) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is (6Z,12S,14R)-pentacyclo[7.5.1.02,12.04,11.010,14]pentadec-6-ene-3,15-dione.
| Compound Name | (6Z,12S,14R)-pentacyclo[7.5.1.02,12.04,11.010,14]pentadec-6-ene-3,15-dione |
|---|---|
| PubChem CID | 135038227 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (6Z,12S,14R)-pentacyclo[7.5.1.02,12.04,11.010,14]pentadec-6-ene-3,15-dione |
| SMILES | O=C1C2C/C=C\CC3C(=O)C4C1[C@H]1C[C@@H]4C3C21 |
| InChI | InChI=1S/C15H16O2/c16-14-6-3-1-2-4-7-11-9-5-8(10(6)11)12(14)13(9)15(7)17/h1-2,6-13H,3-5H2/b2-1-/t6?,7?,8-,9+,10?,11?,12?,13? |
| InChIKey | YJVFZDQVYGVJEF-YCCQNCRFSA-N |
| XLogP | 1.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|