C26H34O — CID 50908923
(6R,9S,17S,20S)-nonacyclo[13.6.2.14,11.16,9.117,20.02,14.03,12.05,10.016,21]hexacosan-13-one (PubChem CID 50908923) has the molecular formula C26H34O and a molecular weight of 362.56 g/mol. Its IUPAC name is (6R,9S,17S,20S)-nonacyclo[13.6.2.14,11.16,9.117,20.02,14.03,12.05,10.016,21]hexacosan-13-one.
| Compound Name | (6R,9S,17S,20S)-nonacyclo[13.6.2.14,11.16,9.117,20.02,14.03,12.05,10.016,21]hexacosan-13-one |
|---|---|
| PubChem CID | 50908923 |
| Molecular Formula | C26H34O |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | (6R,9S,17S,20S)-nonacyclo[13.6.2.14,11.16,9.117,20.02,14.03,12.05,10.016,21]hexacosan-13-one |
| SMILES | O=C1C2C3CC(C2C2C4CCC(C12)C1C4[C@H]2CC[C@H]1C2)C1C3[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C26H34O/c27-26-24-15-6-5-14(18-10-1-2-11(7-10)19(15)18)22(24)23-16-9-17(25(23)26)21-13-4-3-12(8-13)20(16)21/h10-25H,1-9H2/t10-,11-,12+,13-,14?,15?,16?,17?,18?,19?,20?,21?,22?,23?,24?,25?/m0/s1 |
| InChIKey | YJUVCBGGFBYMBC-LZOQEFOHSA-N |
| XLogP | 5.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|