C12H18O2 — CID 10774199
(1R,3R,4R,5S,6S,8S)-tetracyclo[6.2.1.13,6.02,7]dodecane-4,5-diol (PubChem CID 10774199) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (1R,3R,4R,5S,6S,8S)-tetracyclo[6.2.1.13,6.02,7]dodecane-4,5-diol.
| Compound Name | (1R,3R,4R,5S,6S,8S)-tetracyclo[6.2.1.13,6.02,7]dodecane-4,5-diol |
|---|---|
| PubChem CID | 10774199 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (1R,3R,4R,5S,6S,8S)-tetracyclo[6.2.1.13,6.02,7]dodecane-4,5-diol |
| SMILES | O[C@@H]1[C@H](O)C2C[C@H]1C1C2[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C12H18O2/c13-11-7-4-8(12(11)14)10-6-2-1-5(3-6)9(7)10/h5-14H,1-4H2/t5-,6+,7-,8?,9?,10?,11-,12+/m0/s1 |
| InChIKey | MLKBPKWZSHHIJS-XMDIBKCSSA-N |
| XLogP | 1.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|