C13H20O2 — CID 70849409
5-methoxytetracyclo[6.2.1.13,6.02,7]dodecan-4-ol (PubChem CID 70849409) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 5-methoxytetracyclo[6.2.1.13,6.02,7]dodecan-4-ol.
| Compound Name | 5-methoxytetracyclo[6.2.1.13,6.02,7]dodecan-4-ol |
|---|---|
| PubChem CID | 70849409 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 5-methoxytetracyclo[6.2.1.13,6.02,7]dodecan-4-ol |
| SMILES | COC1C(O)C2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C13H20O2/c1-15-13-9-5-8(12(13)14)10-6-2-3-7(4-6)11(9)10/h6-14H,2-5H2,1H3 |
| InChIKey | GJKXDIRGUMAOLH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|