C21H40 — CID 91554389
ethane;pentacyclo[9.2.1.14,7.02,10.03,8]pentadecane (PubChem CID 91554389) has the molecular formula C21H40 and a molecular weight of 292.55 g/mol. Its IUPAC name is ethane;pentacyclo[9.2.1.14,7.02,10.03,8]pentadecane.
| Compound Name | ethane;pentacyclo[9.2.1.14,7.02,10.03,8]pentadecane |
|---|---|
| PubChem CID | 91554389 |
| Molecular Formula | C21H40 |
| Molecular Weight | 292.55 g/mol |
| Exact Mass | 292.31 |
| IUPAC Name | ethane;pentacyclo[9.2.1.14,7.02,10.03,8]pentadecane |
| SMILES | C1CC2CC1C1CC3C4CCC(C4)C3C21.CC.CC.CC |
| InChI | InChI=1S/C15H22.3C2H6/c1-3-10-5-8(1)12-7-13-9-2-4-11(6-9)15(13)14(10)12;3*1-2/h8-15H,1-7H2;3*1-2H3 |
| InChIKey | LNAJVFDMZNQZNQ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.55 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |