C14H26 — CID 90804834
3,4-dimethyltricyclo[5.2.1.02,6]decane;ethane (PubChem CID 90804834) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is 3,4-dimethyltricyclo[5.2.1.02,6]decane;ethane.
| Compound Name | 3,4-dimethyltricyclo[5.2.1.02,6]decane;ethane |
|---|---|
| PubChem CID | 90804834 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 3,4-dimethyltricyclo[5.2.1.02,6]decane;ethane |
| SMILES | CC.CC1CC2C3CCC(C3)C2C1C |
| InChI | InChI=1S/C12H20.C2H6/c1-7-5-11-9-3-4-10(6-9)12(11)8(7)2;1-2/h7-12H,3-6H2,1-2H3;1-2H3 |
| InChIKey | CFVHMEYKSIEXNM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |