C17H22O — CID 59904064
(4S,6R)-5-oxaheptacyclo[7.6.1.13,7.111,14.02,8.04,6.010,15]octadecane (PubChem CID 59904064) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is (4S,6R)-5-oxaheptacyclo[7.6.1.13,7.111,14.02,8.04,6.010,15]octadecane.
| Compound Name | (4S,6R)-5-oxaheptacyclo[7.6.1.13,7.111,14.02,8.04,6.010,15]octadecane |
|---|---|
| PubChem CID | 59904064 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (4S,6R)-5-oxaheptacyclo[7.6.1.13,7.111,14.02,8.04,6.010,15]octadecane |
| SMILES | C1CC2CC1C1C3CC(C21)C1C3C2CC1[C@@H]1O[C@H]21 |
| InChI | InChI=1S/C17H22O/c1-2-7-3-6(1)12-8-4-9(13(7)12)15-11-5-10(14(8)15)16-17(11)18-16/h6-17H,1-5H2/t6?,7?,8?,9?,10?,11?,12?,13?,14?,15?,16-,17+ |
| InChIKey | IDHUIOUZAVBWHF-DARNZKPASA-N |
| XLogP | 2.95 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|