C11H12O — CID 124763737
(1R,2R,3S,4R,6S,7R,8S,9R,10R,12R)-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecane (PubChem CID 124763737) has the molecular formula C11H12O and a molecular weight of 160.22 g/mol. Its IUPAC name is (1R,2R,3S,4R,6S,7R,8S,9R,10R,12R)-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecane.
| Compound Name | (1R,2R,3S,4R,6S,7R,8S,9R,10R,12R)-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecane |
|---|---|
| PubChem CID | 124763737 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (1R,2R,3S,4R,6S,7R,8S,9R,10R,12R)-5-oxahexacyclo[5.4.1.02,6.03,10.04,8.09,12]dodecane |
| SMILES | C1[C@@H]2[C@@H]3[C@H]4[C@@H]1[C@H]1[C@@H]5O[C@@H]([C@@H]3[C@H]54)[C@@H]21 |
| InChI | InChI=1S/C11H12O/c1-2-4-5-3(1)7-6(2)10-8(4)9(5)11(7)12-10/h2-11H,1H2/t2-,3-,4-,5-,6-,7+,8-,9+,10+,11-/m1/s1 |
| InChIKey | BTLTVYGUMREMCE-HNRSEZNOSA-N |
| XLogP | 1.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |