C9H10O4 — CID 15972728
(1S,2R,3S,4S,6R,7S,9R,11R)-8,10,12,13-tetraoxapentacyclo[5.5.1.02,6.03,11.04,9]tridecane (PubChem CID 15972728) has the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. Its IUPAC name is (1S,2R,3S,4S,6R,7S,9R,11R)-8,10,12,13-tetraoxapentacyclo[5.5.1.02,6.03,11.04,9]tridecane.
| Compound Name | (1S,2R,3S,4S,6R,7S,9R,11R)-8,10,12,13-tetraoxapentacyclo[5.5.1.02,6.03,11.04,9]tridecane |
|---|---|
| PubChem CID | 15972728 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (1S,2R,3S,4S,6R,7S,9R,11R)-8,10,12,13-tetraoxapentacyclo[5.5.1.02,6.03,11.04,9]tridecane |
| SMILES | C1[C@@H]2[C@@H]3O[C@H]4O[C@H]5O[C@@H](O3)[C@@H]2[C@H]5[C@@H]14 |
| InChI | InChI=1S/C9H10O4/c1-2-4-5-3(1)7-10-6(2)11-8(4)13-9(5)12-7/h2-9H,1H2/t2-,3+,4-,5+,6+,7-,8+,9- |
| InChIKey | VURYQBPQMLUVBU-RCJZDJILSA-N |
| XLogP | 0.28 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |