About 2,4,14-trioxapentacyclo[6.5.1.03,11.05,10.09,13]tetradecane
2,4,14-trioxapentacyclo[6.5.1.03,11.05,10.09,13]tetradecane (PubChem CID 85176520) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 2,4,14-trioxapentacyclo[6.5.1.03,11.05,10.09,13]tetradecane.
Analyze 2,4,14-trioxapentacyclo[6.5.1.03,11.05,10.09,13]tetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,14-trioxapentacyclo[6.5.1.03,11.05,10.09,13]tetradecane?
The IUPAC name of 2,4,14-trioxapentacyclo[6.5.1.03,11.05,10.09,13]tetradecane (CID 85176520) is 2,4,14-trioxapentacyclo[6.5.1.03,11.05,10.09,13]tetradecane.
What is the SMILES notation for 2,4,14-trioxapentacyclo[6.5.1.03,11.05,10.09,13]tetradecane?
The canonical SMILES for 2,4,14-trioxapentacyclo[6.5.1.03,11.05,10.09,13]tetradecane is C1CC2OC3OC4OC1C1C4CC3C21.
What is the InChIKey of 2,4,14-trioxapentacyclo[6.5.1.03,11.05,10.09,13]tetradecane?
The InChIKey is QOOXEPKNZOCEAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-2-7-9-5-3-4-8(9)6(1)12-10(4)14-11(5)13-7/h4-11H,1-3H2.
What are the key properties of 2,4,14-trioxapentacyclo[6.5.1.03,11.05,10.09,13]tetradecane?
2,4,14-trioxapentacyclo[6.5.1.03,11.05,10.09,13]tetradecane has a molecular weight of 194.23 g/mol, XLogP of 1.13, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,14-trioxapentacyclo[6.5.1.03,11.05,10.09,13]tetradecane is sourced from PubChem (CID 85176520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).