About (6R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-ol
(6R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-ol (PubChem CID 67794006) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is (6R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-ol.
Molecular Properties
| Compound Name | (6R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-ol |
| PubChem CID | 67794006 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (6R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-ol |
| SMILES | OC1OC[C@@H]2C3CCC(O3)C12 |
| InChI | InChI=1S/C8H12O3/c9-8-7-4(3-10-8)5-1-2-6(7)11-5/h4-9H,1-3H2/t4-,5?,6?,7?,8?/m1/s1 |
| InChIKey | JYTQKTKMMXLVJR-BKJPEWSUSA-N |
| XLogP | 0.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-ol?
The IUPAC name of (6R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-ol (CID 67794006) is (6R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-ol.
What is the SMILES notation for (6R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-ol?
The canonical SMILES for (6R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-ol is OC1OC[C@@H]2C3CCC(O3)C12.
What is the InChIKey of (6R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-ol?
The InChIKey is JYTQKTKMMXLVJR-BKJPEWSUSA-N. The full InChI is InChI=1S/C8H12O3/c9-8-7-4(3-10-8)5-1-2-6(7)11-5/h4-9H,1-3H2/t4-,5?,6?,7?,8?/m1/s1.
What are the key properties of (6R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-ol?
(6R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-ol has a molecular weight of 156.18 g/mol, XLogP of 0.13, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-4,10-dioxatricyclo[5.2.1.02,6]decan-3-ol is sourced from PubChem (CID 67794006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).