C8H10O3 — CID 13388579
(1R,2S,3R,6S,7S)-4,10-dioxatricyclo[5.2.1.02,6]dec-8-en-3-ol (PubChem CID 13388579) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is (1R,2S,3R,6S,7S)-4,10-dioxatricyclo[5.2.1.02,6]dec-8-en-3-ol.
| Compound Name | (1R,2S,3R,6S,7S)-4,10-dioxatricyclo[5.2.1.02,6]dec-8-en-3-ol |
|---|---|
| PubChem CID | 13388579 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (1R,2S,3R,6S,7S)-4,10-dioxatricyclo[5.2.1.02,6]dec-8-en-3-ol |
| SMILES | O[C@@H]1OC[C@@H]2[C@H]1[C@H]1C=C[C@@H]2O1 |
| InChI | InChI=1S/C8H10O3/c9-8-7-4(3-10-8)5-1-2-6(7)11-5/h1-2,4-9H,3H2/t4-,5-,6+,7-,8+/m0/s1 |
| InChIKey | ZQGGYTWIYSHIPC-YOWKYNACSA-N |
| XLogP | -0.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|