C9H12O2 — CID 550026
4-oxatricyclo[5.2.1.02,6]dec-8-en-3-ol (PubChem CID 550026) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 4-oxatricyclo[5.2.1.02,6]dec-8-en-3-ol.
| Compound Name | 4-oxatricyclo[5.2.1.02,6]dec-8-en-3-ol |
|---|---|
| PubChem CID | 550026 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 4-oxatricyclo[5.2.1.02,6]dec-8-en-3-ol |
| SMILES | OC1OCC2C3C=CC(C3)C12 |
| InChI | InChI=1S/C9H12O2/c10-9-8-6-2-1-5(3-6)7(8)4-11-9/h1-2,5-10H,3-4H2 |
| InChIKey | MSPXLDIYOLJENY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|