C10H14O2 — CID 95565725
(2R,4S,7R,9S)-tricyclo[5.2.1.04,10]dec-5-ene-2,9-diol (PubChem CID 95565725) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (2R,4S,7R,9S)-tricyclo[5.2.1.04,10]dec-5-ene-2,9-diol.
| Compound Name | (2R,4S,7R,9S)-tricyclo[5.2.1.04,10]dec-5-ene-2,9-diol |
|---|---|
| PubChem CID | 95565725 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (2R,4S,7R,9S)-tricyclo[5.2.1.04,10]dec-5-ene-2,9-diol |
| SMILES | O[C@@H]1C[C@H]2C=C[C@H]3C[C@H](O)C1C23 |
| InChI | InChI=1S/C10H14O2/c11-7-3-5-1-2-6-4-8(12)10(7)9(5)6/h1-2,5-12H,3-4H2/t5-,6+,7-,8+,9?,10? |
| InChIKey | KMEWXMMVQQNLKQ-QGPWORDESA-N |
| XLogP | 0.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|