C7H10O2 — CID 131089287
(1R,2S,4R,7R)-bicyclo[2.2.1]hept-5-ene-2,7-diol (PubChem CID 131089287) has the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. Its IUPAC name is (1R,2S,4R,7R)-bicyclo[2.2.1]hept-5-ene-2,7-diol.
| Compound Name | (1R,2S,4R,7R)-bicyclo[2.2.1]hept-5-ene-2,7-diol |
|---|---|
| PubChem CID | 131089287 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | (1R,2S,4R,7R)-bicyclo[2.2.1]hept-5-ene-2,7-diol |
| SMILES | O[C@H]1[C@@H]2C=C[C@H]1C[C@@H]2O |
| InChI | InChI=1S/C7H10O2/c8-6-3-4-1-2-5(6)7(4)9/h1-2,4-9H,3H2/t4-,5+,6-,7+/m0/s1 |
| InChIKey | AUTSEJSAHVUKLO-BNHYGAARSA-N |
| XLogP | -0.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|