C9H10O2 — CID 98474774
(1S,2R,4S,5R,6S)-4-hydroxytricyclo[4.2.1.02,5]non-7-en-3-one (PubChem CID 98474774) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is (1S,2R,4S,5R,6S)-4-hydroxytricyclo[4.2.1.02,5]non-7-en-3-one.
| Compound Name | (1S,2R,4S,5R,6S)-4-hydroxytricyclo[4.2.1.02,5]non-7-en-3-one |
|---|---|
| PubChem CID | 98474774 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | (1S,2R,4S,5R,6S)-4-hydroxytricyclo[4.2.1.02,5]non-7-en-3-one |
| SMILES | O=C1[C@H]2[C@@H]([C@@H]3C=C[C@@H]2C3)[C@@H]1O |
| InChI | InChI=1S/C9H10O2/c10-8-6-4-1-2-5(3-4)7(6)9(8)11/h1-2,4-8,10H,3H2/t4-,5-,6-,7-,8+/m1/s1 |
| InChIKey | UDDIWRLVXQHDBU-PVFLNQBWSA-N |
| XLogP | 0.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|