C16H26OSi — CID 11414353
(1S,2S,4R,5S,6R,7R)-5-propan-2-yl-4-trimethylsilyltricyclo[5.2.1.02,6]dec-8-en-3-one (PubChem CID 11414353) has the molecular formula C16H26OSi and a molecular weight of 262.47 g/mol. Its IUPAC name is (1S,2S,4R,5S,6R,7R)-5-propan-2-yl-4-trimethylsilyltricyclo[5.2.1.02,6]dec-8-en-3-one.
| Compound Name | (1S,2S,4R,5S,6R,7R)-5-propan-2-yl-4-trimethylsilyltricyclo[5.2.1.02,6]dec-8-en-3-one |
|---|---|
| PubChem CID | 11414353 |
| Molecular Formula | C16H26OSi |
| Molecular Weight | 262.47 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (1S,2S,4R,5S,6R,7R)-5-propan-2-yl-4-trimethylsilyltricyclo[5.2.1.02,6]dec-8-en-3-one |
| SMILES | CC(C)[C@H]1[C@H]2[C@@H](C(=O)[C@@H]1[Si](C)(C)C)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C16H26OSi/c1-9(2)12-13-10-6-7-11(8-10)14(13)15(17)16(12)18(3,4)5/h6-7,9-14,16H,8H2,1-5H3/t10-,11+,12-,13-,14-,16+/m0/s1 |
| InChIKey | HTLGVUWOCGRMAZ-NJPIGMNZSA-N |
| XLogP | 3.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|