C16H22O5 — CID 23249737
[(1R,2R,3S,5S,7S,8S)-6-oxo-5-propan-2-yloxy-4-oxatricyclo[6.2.1.02,7]undec-9-en-3-yl]methyl acetate (PubChem CID 23249737) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is [(1R,2R,3S,5S,7S,8S)-6-oxo-5-propan-2-yloxy-4-oxatricyclo[6.2.1.02,7]undec-9-en-3-yl]methyl acetate.
| Compound Name | [(1R,2R,3S,5S,7S,8S)-6-oxo-5-propan-2-yloxy-4-oxatricyclo[6.2.1.02,7]undec-9-en-3-yl]methyl acetate |
|---|---|
| PubChem CID | 23249737 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | [(1R,2R,3S,5S,7S,8S)-6-oxo-5-propan-2-yloxy-4-oxatricyclo[6.2.1.02,7]undec-9-en-3-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC(C)C)C(=O)[C@@H]2[C@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C16H22O5/c1-8(2)20-16-15(18)14-11-5-4-10(6-11)13(14)12(21-16)7-19-9(3)17/h4-5,8,10-14,16H,6-7H2,1-3H3/t10-,11+,12+,13-,14-,16-/m0/s1 |
| InChIKey | ARRVYUFTHSHFQY-HEIVXVCXSA-N |
| XLogP | 1.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|